C17H31ClN6O3 — CID 140643867
2-amino-6-chloro-N-[4-(oxan-3-yloxy)piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 140643867) has the molecular formula C17H31ClN6O3 and a molecular weight of 402.93 g/mol. Its IUPAC name is 2-amino-6-chloro-N-[4-(oxan-3-yloxy)piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-6-chloro-N-[4-(oxan-3-yloxy)piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 140643867 |
| Molecular Formula | C17H31ClN6O3 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-amino-6-chloro-N-[4-(oxan-3-yloxy)piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | NC1NN2CC(Cl)CNC2C1C(=O)NC1CNCCC1OC1CCCOC1 |
| InChI | InChI=1S/C17H31ClN6O3/c18-10-6-21-16-14(15(19)23-24(16)8-10)17(25)22-12-7-20-4-3-13(12)27-11-2-1-5-26-9-11/h10-16,20-21,23H,1-9,19H2,(H,22,25) |
| InChIKey | FEYNJBRICSRKBA-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|