C18H34ClN7O2 — CID 129134667
2-amino-6-chloro-4-methyl-N-[4-[(3S)-piperidin-3-yl]oxypiperidin-3-yl]-2,3,3a,5,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 129134667) has the molecular formula C18H34ClN7O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 2-amino-6-chloro-4-methyl-N-[4-[(3S)-piperidin-3-yl]oxypiperidin-3-yl]-2,3,3a,5,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-6-chloro-4-methyl-N-[4-[(3S)-piperidin-3-yl]oxypiperidin-3-yl]-2,3,3a,5,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 129134667 |
| Molecular Formula | C18H34ClN7O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 2-amino-6-chloro-4-methyl-N-[4-[(3S)-piperidin-3-yl]oxypiperidin-3-yl]-2,3,3a,5,6,7-hexahydro-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CN1CC(Cl)CN2NC(N)C(C(=O)NC3CNCCC3O[C@H]3CCCNC3)C12 |
| InChI | InChI=1S/C18H34ClN7O2/c1-25-9-11(19)10-26-18(25)15(16(20)24-26)17(27)23-13-8-22-6-4-14(13)28-12-3-2-5-21-7-12/h11-16,18,21-22,24H,2-10,20H2,1H3,(H,23,27)/t11?,12-,13?,14?,15?,16?,18?/m0/s1 |
| InChIKey | OBUWJYWJVLJIJK-NMIGMSNOSA-N |
| XLogP | -1.80 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|