C21H25N3O4 — CID 134579763
2-(2,6-dioxopiperidin-3-yl)-4-(4-pyrrolidin-3-ylbutyl)isoindole-1,3-dione (PubChem CID 134579763) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(4-pyrrolidin-3-ylbutyl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(4-pyrrolidin-3-ylbutyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134579763 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(4-pyrrolidin-3-ylbutyl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CCCCC4CCNC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H25N3O4/c25-17-9-8-16(19(26)23-17)24-20(27)15-7-3-6-14(18(15)21(24)28)5-2-1-4-13-10-11-22-12-13/h3,6-7,13,16,22H,1-2,4-5,8-12H2,(H,23,25,26) |
| InChIKey | QTTPFSBFJROQKW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|