C18H39N3O — CID 134579953
3-[2-[4-(2,3-dimethylbutan-2-yl)piperazin-1-yl]ethoxy]-N-propan-2-ylpropan-1-amine (PubChem CID 134579953) has the molecular formula C18H39N3O and a molecular weight of 313.53 g/mol. Its IUPAC name is 3-[2-[4-(2,3-dimethylbutan-2-yl)piperazin-1-yl]ethoxy]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-[2-[4-(2,3-dimethylbutan-2-yl)piperazin-1-yl]ethoxy]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 134579953 |
| Molecular Formula | C18H39N3O |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.31 |
| IUPAC Name | 3-[2-[4-(2,3-dimethylbutan-2-yl)piperazin-1-yl]ethoxy]-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)NCCCOCCN1CCN(C(C)(C)C(C)C)CC1 |
| InChI | InChI=1S/C18H39N3O/c1-16(2)18(5,6)21-11-9-20(10-12-21)13-15-22-14-7-8-19-17(3)4/h16-17,19H,7-15H2,1-6H3 |
| InChIKey | UCIIYTYIDAAMBC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|