C13H11FN2O4 — CID 134581950
2-(2,6-dioxopiperidin-3-yl)-5-fluoro-5,6-dihydroisoindole-1,3-dione (PubChem CID 134581950) has the molecular formula C13H11FN2O4 and a molecular weight of 278.24 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-5,6-dihydroisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-5,6-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 134581950 |
| Molecular Formula | C13H11FN2O4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-5,6-dihydroisoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)C3=CCC(F)C=C3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H11FN2O4/c14-6-1-2-7-8(5-6)13(20)16(12(7)19)9-3-4-10(17)15-11(9)18/h2,5-6,9H,1,3-4H2,(H,15,17,18) |
| InChIKey | XUJMZHQXHOGLQZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|