C22H24N4O6S2 — CID 134582079
[3-anilino-2-[2-(methanesulfonamido)-4-pyridinyl]-4-oxo-1,5,6,7-tetrahydroindol-6-yl]methyl methanesulfonate (PubChem CID 134582079) has the molecular formula C22H24N4O6S2 and a molecular weight of 504.59 g/mol. Its IUPAC name is [3-anilino-2-[2-(methanesulfonamido)-4-pyridinyl]-4-oxo-1,5,6,7-tetrahydroindol-6-yl]methyl methanesulfonate.
| Compound Name | [3-anilino-2-[2-(methanesulfonamido)-4-pyridinyl]-4-oxo-1,5,6,7-tetrahydroindol-6-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 134582079 |
| Molecular Formula | C22H24N4O6S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | [3-anilino-2-[2-(methanesulfonamido)-4-pyridinyl]-4-oxo-1,5,6,7-tetrahydroindol-6-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)Nc1cc(-c2[nH]c3c(c2Nc2ccccc2)C(=O)CC(COS(C)(=O)=O)C3)ccn1 |
| InChI | InChI=1S/C22H24N4O6S2/c1-33(28,29)26-19-12-15(8-9-23-19)21-22(24-16-6-4-3-5-7-16)20-17(25-21)10-14(11-18(20)27)13-32-34(2,30)31/h3-9,12,14,24-25H,10-11,13H2,1-2H3,(H,23,26) |
| InChIKey | OAPALPMVCWAHRV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|