C36H37N3O2Si — CID 140892969
3-anilino-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-pyridin-4-yl-1,5,6,7-tetrahydroindol-4-one (PubChem CID 140892969) has the molecular formula C36H37N3O2Si and a molecular weight of 571.80 g/mol. Its IUPAC name is 3-anilino-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-pyridin-4-yl-1,5,6,7-tetrahydroindol-4-one.
| Compound Name | 3-anilino-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-pyridin-4-yl-1,5,6,7-tetrahydroindol-4-one |
|---|---|
| PubChem CID | 140892969 |
| Molecular Formula | C36H37N3O2Si |
| Molecular Weight | 571.80 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | 3-anilino-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-pyridin-4-yl-1,5,6,7-tetrahydroindol-4-one |
| SMILES | CC(C)(C)[Si](OCC1CC(=O)c2c([nH]c(-c3ccncc3)c2Nc2ccccc2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H37N3O2Si/c1-36(2,3)42(29-15-9-5-10-16-29,30-17-11-6-12-18-30)41-25-26-23-31-33(32(40)24-26)35(38-28-13-7-4-8-14-28)34(39-31)27-19-21-37-22-20-27/h4-22,26,38-39H,23-25H2,1-3H3 |
| InChIKey | COEPEBJYCPRESW-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.80 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|