C20H38F2N2O3 — CID 134582276
1-tert-butyl-3-[3-[3-(1-tert-butylazetidin-3-yl)oxy-2,2-difluoropropoxy]propoxy]azetidine (PubChem CID 134582276) has the molecular formula C20H38F2N2O3 and a molecular weight of 392.53 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-[3-(1-tert-butylazetidin-3-yl)oxy-2,2-difluoropropoxy]propoxy]azetidine.
| Compound Name | 1-tert-butyl-3-[3-[3-(1-tert-butylazetidin-3-yl)oxy-2,2-difluoropropoxy]propoxy]azetidine |
|---|---|
| PubChem CID | 134582276 |
| Molecular Formula | C20H38F2N2O3 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 1-tert-butyl-3-[3-[3-(1-tert-butylazetidin-3-yl)oxy-2,2-difluoropropoxy]propoxy]azetidine |
| SMILES | CC(C)(C)N1CC(OCCCOCC(F)(F)COC2CN(C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C20H38F2N2O3/c1-18(2,3)23-10-16(11-23)26-9-7-8-25-14-20(21,22)15-27-17-12-24(13-17)19(4,5)6/h16-17H,7-15H2,1-6H3 |
| InChIKey | RLBFAODYEYCHRZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|