C19H25NO2 — CID 134583052
3-[4-(2,2-dimethylpropoxymethyl)phenoxy]-N-methylaniline (PubChem CID 134583052) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 3-[4-(2,2-dimethylpropoxymethyl)phenoxy]-N-methylaniline.
| Compound Name | 3-[4-(2,2-dimethylpropoxymethyl)phenoxy]-N-methylaniline |
|---|---|
| PubChem CID | 134583052 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 3-[4-(2,2-dimethylpropoxymethyl)phenoxy]-N-methylaniline |
| SMILES | CNc1cccc(Oc2ccc(COCC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C19H25NO2/c1-19(2,3)14-21-13-15-8-10-17(11-9-15)22-18-7-5-6-16(12-18)20-4/h5-12,20H,13-14H2,1-4H3 |
| InChIKey | QWYULLLOGGJECO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |