C27H22N4O3 — CID 123635103
3-[4-[5-[4-[3-(methylamino)phenoxy]phenyl]-1,3,4-oxadiazol-2-yl]phenoxy]aniline (PubChem CID 123635103) has the molecular formula C27H22N4O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 3-[4-[5-[4-[3-(methylamino)phenoxy]phenyl]-1,3,4-oxadiazol-2-yl]phenoxy]aniline.
| Compound Name | 3-[4-[5-[4-[3-(methylamino)phenoxy]phenyl]-1,3,4-oxadiazol-2-yl]phenoxy]aniline |
|---|---|
| PubChem CID | 123635103 |
| Molecular Formula | C27H22N4O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 3-[4-[5-[4-[3-(methylamino)phenoxy]phenyl]-1,3,4-oxadiazol-2-yl]phenoxy]aniline |
| SMILES | CNc1cccc(Oc2ccc(-c3nnc(-c4ccc(Oc5cccc(N)c5)cc4)o3)cc2)c1 |
| InChI | InChI=1S/C27H22N4O3/c1-29-21-5-3-7-25(17-21)33-23-14-10-19(11-15-23)27-31-30-26(34-27)18-8-12-22(13-9-18)32-24-6-2-4-20(28)16-24/h2-17,29H,28H2,1H3 |
| InChIKey | AUOXYRDBVQKFDC-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|