C26H24N2O2 — CID 18517163
3-[4-[4-(3-aminophenoxy)-3,5-dimethylphenyl]phenoxy]aniline (PubChem CID 18517163) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3-[4-[4-(3-aminophenoxy)-3,5-dimethylphenyl]phenoxy]aniline.
| Compound Name | 3-[4-[4-(3-aminophenoxy)-3,5-dimethylphenyl]phenoxy]aniline |
|---|---|
| PubChem CID | 18517163 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3-[4-[4-(3-aminophenoxy)-3,5-dimethylphenyl]phenoxy]aniline |
| SMILES | Cc1cc(-c2ccc(Oc3cccc(N)c3)cc2)cc(C)c1Oc1cccc(N)c1 |
| InChI | InChI=1S/C26H24N2O2/c1-17-13-20(14-18(2)26(17)30-25-8-4-6-22(28)16-25)19-9-11-23(12-10-19)29-24-7-3-5-21(27)15-24/h3-16H,27-28H2,1-2H3 |
| InChIKey | KZGXKAPDSOGTQO-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|