C24H29F2N5O4 — CID 134584835
2-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-4-ethyl-N-(3-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 134584835) has the molecular formula C24H29F2N5O4 and a molecular weight of 489.52 g/mol. Its IUPAC name is 2-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-4-ethyl-N-(3-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 2-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-4-ethyl-N-(3-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 134584835 |
| Molecular Formula | C24H29F2N5O4 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-4-ethyl-N-(3-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)Nc2cccc(OC)c2)C(Cc2ccc(C(=O)NNC(=O)C(F)F)cc2)C1 |
| InChI | InChI=1S/C24H29F2N5O4/c1-3-30-11-12-31(24(34)27-18-5-4-6-20(14-18)35-2)19(15-30)13-16-7-9-17(10-8-16)22(32)28-29-23(33)21(25)26/h4-10,14,19,21H,3,11-13,15H2,1-2H3,(H,27,34)(H,28,32)(H,29,33) |
| InChIKey | AHCRYCCXTNOQFI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|