About 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate
2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate (PubChem CID 134585062) has the molecular formula C23H48O5
and a molecular weight of 404.63 g/mol. Its IUPAC name is 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate.
Molecular Properties
| Compound Name | 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate |
| PubChem CID | 134585062 |
| Molecular Formula | C23H48O5 |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.35 |
| IUPAC Name | 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate |
| SMILES | CC(O)COC(C)CO.CCCCCCCCCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C17H34O2.C6H14O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(18)19-16(2)3;1-5(8)4-9-6(2)3-7/h16H,4-15H2,1-3H3;5-8H,3-4H2,1-2H3 |
| InChIKey | TWVSLTMZMVNGBV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate?
The IUPAC name of 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate (CID 134585062) is 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate.
What is the SMILES notation for 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate?
The canonical SMILES for 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate is CC(O)COC(C)CO.CCCCCCCCCCCCCC(=O)OC(C)C.
What is the InChIKey of 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate?
The InChIKey is TWVSLTMZMVNGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2.C6H14O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(18)19-16(2)3;1-5(8)4-9-6(2)3-7/h16H,4-15H2,1-3H3;5-8H,3-4H2,1-2H3.
What are the key properties of 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate?
2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate has a molecular weight of 404.63 g/mol, XLogP of 5.40, 17 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxypropoxy)propan-1-ol;propan-2-yl tetradecanoate is sourced from PubChem (CID 134585062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).