C10H5F2N5O4S2 — CID 134586150
(4-azido-2,6-difluorophenyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid (PubChem CID 134586150) has the molecular formula C10H5F2N5O4S2 and a molecular weight of 361.31 g/mol. Its IUPAC name is (4-azido-2,6-difluorophenyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid.
| Compound Name | (4-azido-2,6-difluorophenyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid |
|---|---|
| PubChem CID | 134586150 |
| Molecular Formula | C10H5F2N5O4S2 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | (4-azido-2,6-difluorophenyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid |
| SMILES | [N-]=[N+]=Nc1cc(F)c(S(=O)(=O)N(C(=O)O)c2cscn2)c(F)c1 |
| InChI | InChI=1S/C10H5F2N5O4S2/c11-6-1-5(15-16-13)2-7(12)9(6)23(20,21)17(10(18)19)8-3-22-4-14-8/h1-4H,(H,18,19) |
| InChIKey | GUGQBAVZSKJDKT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 136.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|