C19H18IN3O — CID 134588162
6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-iodo-1,8-naphthyridin-4-one (PubChem CID 134588162) has the molecular formula C19H18IN3O and a molecular weight of 431.28 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-iodo-1,8-naphthyridin-4-one.
| Compound Name | 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-iodo-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 134588162 |
| Molecular Formula | C19H18IN3O |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 6-(2,3-dihydro-1H-inden-2-ylamino)-1-ethyl-3-iodo-1,8-naphthyridin-4-one |
| SMILES | CCn1cc(I)c(=O)c2cc(NC3Cc4ccccc4C3)cnc21 |
| InChI | InChI=1S/C19H18IN3O/c1-2-23-11-17(20)18(24)16-9-15(10-21-19(16)23)22-14-7-12-5-3-4-6-13(12)8-14/h3-6,9-11,14,22H,2,7-8H2,1H3 |
| InChIKey | JEYJSZDZOUUAAG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|