C30H40ClN5O4 — CID 134588953
methyl N-[(2S)-1-[4-[(4R)-2-amino-4-(2-methylpropyl)-5-oxo-4-phenylimidazol-1-yl]hexylamino]-3-(2-chlorophenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 134588953) has the molecular formula C30H40ClN5O4 and a molecular weight of 570.13 g/mol. Its IUPAC name is methyl N-[(2S)-1-[4-[(4R)-2-amino-4-(2-methylpropyl)-5-oxo-4-phenylimidazol-1-yl]hexylamino]-3-(2-chlorophenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[4-[(4R)-2-amino-4-(2-methylpropyl)-5-oxo-4-phenylimidazol-1-yl]hexylamino]-3-(2-chlorophenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 134588953 |
| Molecular Formula | C30H40ClN5O4 |
| Molecular Weight | 570.13 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | methyl N-[(2S)-1-[4-[(4R)-2-amino-4-(2-methylpropyl)-5-oxo-4-phenylimidazol-1-yl]hexylamino]-3-(2-chlorophenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCC(CCCNC(=O)[C@H](Cc1ccccc1Cl)NC(=O)OC)N1C(=O)[C@@](CC(C)C)(c2ccccc2)N=C1N |
| InChI | InChI=1S/C30H40ClN5O4/c1-5-23(36-27(38)30(19-20(2)3,35-28(36)32)22-13-7-6-8-14-22)15-11-17-33-26(37)25(34-29(39)40-4)18-21-12-9-10-16-24(21)31/h6-10,12-14,16,20,23,25H,5,11,15,17-19H2,1-4H3,(H2,32,35)(H,33,37)(H,34,39)/t23?,25-,30+/m0/s1 |
| InChIKey | BFLBDRYIEWIWCL-SMNWGGJPSA-N |
| XLogP | 4.38 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.13 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|