C31H44ClN5O4 — CID 154964043
(2S)-N-[(4S)-1-[(4R)-2-amino-4-(2-methylpropyl)-5-oxo-4-phenylimidazol-1-yl]heptan-4-yl]-3-(4-chlorophenyl)-2-[[hydroxy(methoxy)methyl]amino]propanamide (PubChem CID 154964043) has the molecular formula C31H44ClN5O4 and a molecular weight of 586.18 g/mol. Its IUPAC name is (2S)-N-[(4S)-1-[(4R)-2-amino-4-(2-methylpropyl)-5-oxo-4-phenylimidazol-1-yl]heptan-4-yl]-3-(4-chlorophenyl)-2-[[hydroxy(methoxy)methyl]amino]propanamide.
| Compound Name | (2S)-N-[(4S)-1-[(4R)-2-amino-4-(2-methylpropyl)-5-oxo-4-phenylimidazol-1-yl]heptan-4-yl]-3-(4-chlorophenyl)-2-[[hydroxy(methoxy)methyl]amino]propanamide |
|---|---|
| PubChem CID | 154964043 |
| Molecular Formula | C31H44ClN5O4 |
| Molecular Weight | 586.18 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | (2S)-N-[(4S)-1-[(4R)-2-amino-4-(2-methylpropyl)-5-oxo-4-phenylimidazol-1-yl]heptan-4-yl]-3-(4-chlorophenyl)-2-[[hydroxy(methoxy)methyl]amino]propanamide |
| SMILES | CCC[C@@H](CCCN1C(=O)[C@@](CC(C)C)(c2ccccc2)N=C1N)NC(=O)[C@H](Cc1ccc(Cl)cc1)NC(O)OC |
| InChI | InChI=1S/C31H44ClN5O4/c1-5-10-25(34-27(38)26(35-30(40)41-4)19-22-14-16-24(32)17-15-22)13-9-18-37-28(39)31(20-21(2)3,36-29(37)33)23-11-7-6-8-12-23/h6-8,11-12,14-17,21,25-26,30,35,40H,5,9-10,13,18-20H2,1-4H3,(H2,33,36)(H,34,38)/t25-,26-,30?,31+/m0/s1 |
| InChIKey | BFBJCIUKSYUFHF-RDMYVLJUSA-N |
| XLogP | 3.93 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.18 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|