C30H33N5O4 — CID 157129627
methyl N-[(2S)-8-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-3-oxo-1-pyridin-4-yloctan-2-yl]carbamate (PubChem CID 157129627) has the molecular formula C30H33N5O4 and a molecular weight of 527.63 g/mol. Its IUPAC name is methyl N-[(2S)-8-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-3-oxo-1-pyridin-4-yloctan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-8-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-3-oxo-1-pyridin-4-yloctan-2-yl]carbamate |
|---|---|
| PubChem CID | 157129627 |
| Molecular Formula | C30H33N5O4 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | methyl N-[(2S)-8-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-3-oxo-1-pyridin-4-yloctan-2-yl]carbamate |
| SMILES | COC(=O)N[C@@H](Cc1ccncc1)C(=O)CCCCCN1C(=O)C(c2ccccc2)(c2ccccc2)N=C1N |
| InChI | InChI=1S/C30H33N5O4/c1-39-29(38)33-25(21-22-16-18-32-19-17-22)26(36)15-9-4-10-20-35-27(37)30(34-28(35)31,23-11-5-2-6-12-23)24-13-7-3-8-14-24/h2-3,5-8,11-14,16-19,25H,4,9-10,15,20-21H2,1H3,(H2,31,34)(H,33,38)/t25-/m0/s1 |
| InChIKey | AIXITRZIZZHIME-VWLOTQADSA-N |
| XLogP | 3.58 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|