C33H38N4O4 — CID 153127699
propan-2-yl N-[(2S)-8-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-3-oxo-1-phenyloctan-2-yl]carbamate (PubChem CID 153127699) has the molecular formula C33H38N4O4 and a molecular weight of 554.69 g/mol. Its IUPAC name is propan-2-yl N-[(2S)-8-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-3-oxo-1-phenyloctan-2-yl]carbamate.
| Compound Name | propan-2-yl N-[(2S)-8-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-3-oxo-1-phenyloctan-2-yl]carbamate |
|---|---|
| PubChem CID | 153127699 |
| Molecular Formula | C33H38N4O4 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | propan-2-yl N-[(2S)-8-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)-3-oxo-1-phenyloctan-2-yl]carbamate |
| SMILES | CC(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)CCCCCN1C(=O)C(c2ccccc2)(c2ccccc2)N=C1N |
| InChI | InChI=1S/C33H38N4O4/c1-24(2)41-32(40)35-28(23-25-15-7-3-8-16-25)29(38)21-13-6-14-22-37-30(39)33(36-31(37)34,26-17-9-4-10-18-26)27-19-11-5-12-20-27/h3-5,7-12,15-20,24,28H,6,13-14,21-23H2,1-2H3,(H2,34,36)(H,35,40)/t28-/m0/s1 |
| InChIKey | VWCLNEAGCNCBLK-NDEPHWFRSA-N |
| XLogP | 4.96 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|