C28H38N4O2 — CID 162054517
2-amino-3-[(7S)-7-amino-6-oxo-8-phenyloctyl]-5-(3-methylbutyl)-5-phenylimidazol-4-one (PubChem CID 162054517) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 2-amino-3-[(7S)-7-amino-6-oxo-8-phenyloctyl]-5-(3-methylbutyl)-5-phenylimidazol-4-one.
| Compound Name | 2-amino-3-[(7S)-7-amino-6-oxo-8-phenyloctyl]-5-(3-methylbutyl)-5-phenylimidazol-4-one |
|---|---|
| PubChem CID | 162054517 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 2-amino-3-[(7S)-7-amino-6-oxo-8-phenyloctyl]-5-(3-methylbutyl)-5-phenylimidazol-4-one |
| SMILES | CC(C)CCC1(c2ccccc2)N=C(N)N(CCCCCC(=O)[C@@H](N)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C28H38N4O2/c1-21(2)17-18-28(23-14-8-4-9-15-23)26(34)32(27(30)31-28)19-11-5-10-16-25(33)24(29)20-22-12-6-3-7-13-22/h3-4,6-9,12-15,21,24H,5,10-11,16-20,29H2,1-2H3,(H2,30,31)/t24-,28?/m0/s1 |
| InChIKey | YYZOBXUTUPEELC-ZZDYIDRTSA-N |
| XLogP | 4.17 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|