C28H41N5O2 — CID 154964046
(2S)-2-amino-N-[4-[4-amino-6-(3-methylbutyl)-6-phenyl-2,7-dihydro-1,3,5-oxadiazepin-3-yl]butyl]-3-phenylpropanamide (PubChem CID 154964046) has the molecular formula C28H41N5O2 and a molecular weight of 479.67 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-[4-amino-6-(3-methylbutyl)-6-phenyl-2,7-dihydro-1,3,5-oxadiazepin-3-yl]butyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[4-[4-amino-6-(3-methylbutyl)-6-phenyl-2,7-dihydro-1,3,5-oxadiazepin-3-yl]butyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 154964046 |
| Molecular Formula | C28H41N5O2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | (2S)-2-amino-N-[4-[4-amino-6-(3-methylbutyl)-6-phenyl-2,7-dihydro-1,3,5-oxadiazepin-3-yl]butyl]-3-phenylpropanamide |
| SMILES | CC(C)CCC1(c2ccccc2)COCN(CCCCNC(=O)[C@@H](N)Cc2ccccc2)C(N)=N1 |
| InChI | InChI=1S/C28H41N5O2/c1-22(2)15-16-28(24-13-7-4-8-14-24)20-35-21-33(27(30)32-28)18-10-9-17-31-26(34)25(29)19-23-11-5-3-6-12-23/h3-8,11-14,22,25H,9-10,15-21,29H2,1-2H3,(H2,30,32)(H,31,34)/t25-,28?/m0/s1 |
| InChIKey | DSOAHEZAEAKGHZ-ALLRNTDFSA-N |
| XLogP | 3.39 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|