C25H24FN5O2 — CID 11568495
1-[3-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)propyl]-3-(2-fluorophenyl)urea (PubChem CID 11568495) has the molecular formula C25H24FN5O2 and a molecular weight of 445.50 g/mol. Its IUPAC name is 1-[3-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)propyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[3-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)propyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 11568495 |
| Molecular Formula | C25H24FN5O2 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 1-[3-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)propyl]-3-(2-fluorophenyl)urea |
| SMILES | NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1CCCNC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C25H24FN5O2/c26-20-14-7-8-15-21(20)29-24(33)28-16-9-17-31-22(32)25(30-23(31)27,18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-8,10-15H,9,16-17H2,(H2,27,30)(H2,28,29,33) |
| InChIKey | PYXUKJASMGUSGF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|