C29H30N4O2 — CID 89005013
trans-(1R,2R)-N-[4-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)butyl]-2-phenylcyclopropane-1-carboxamide (PubChem CID 89005013) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is trans-(1R,2R)-N-[4-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)butyl]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[4-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)butyl]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 89005013 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | trans-(1R,2R)-N-[4-(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)butyl]-2-phenylcyclopropane-1-carboxamide |
| SMILES | NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1CCCCNC(=O)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H30N4O2/c30-28-32-29(22-14-6-2-7-15-22,23-16-8-3-9-17-23)27(35)33(28)19-11-10-18-31-26(34)25-20-24(25)21-12-4-1-5-13-21/h1-9,12-17,24-25H,10-11,18-20H2,(H2,30,32)(H,31,34)/t24-,25+/m0/s1 |
| InChIKey | HKYGZMRFDOQLNK-LOSJGSFVSA-N |
| XLogP | 3.79 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|