C12H11NO — CID 134590820
(3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine (PubChem CID 134590820) has the molecular formula C12H11NO and a molecular weight of 185.23 g/mol. Its IUPAC name is (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine.
| Compound Name | (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine |
|---|---|
| PubChem CID | 134590820 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine |
| SMILES | C=C1/C=C\C=C/Cc2ccncc2O1 |
| InChI | InChI=1S/C12H11NO/c1-10-5-3-2-4-6-11-7-8-13-9-12(11)14-10/h2-5,7-9H,1,6H2/b4-2-,5-3- |
| InChIKey | HLRUAGKRAVWSQW-JVLMNHKTSA-N |
| XLogP | 2.64 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |