About (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine
(3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine (PubChem CID 134590820) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine.
Molecular Properties
| Compound Name | (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine |
| PubChem CID | 134590820 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine |
| SMILES | C=C1/C=C\C=C/Cc2ccncc2O1 |
| InChI | InChI=1S/C12H11NO/c1-10-5-3-2-4-6-11-7-8-13-9-12(11)14-10/h2-5,7-9H,1,6H2/b4-2-,5-3- |
| InChIKey | HLRUAGKRAVWSQW-JVLMNHKTSA-N |
| XLogP | 2.64 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine?
The IUPAC name of (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine (CID 134590820) is (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine.
What is the SMILES notation for (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine?
The canonical SMILES for (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine is C=C1/C=C\C=C/Cc2ccncc2O1.
What is the InChIKey of (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine?
The InChIKey is HLRUAGKRAVWSQW-JVLMNHKTSA-N. The full InChI is InChI=1S/C12H11NO/c1-10-5-3-2-4-6-11-7-8-13-9-12(11)14-10/h2-5,7-9H,1,6H2/b4-2-,5-3-.
What are the key properties of (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine?
(3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine has a molecular weight of 185.23 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-2-methylidene-7H-oxonino[2,3-c]pyridine is sourced from PubChem (CID 134590820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).