C11H11N2+ — CID 159042161
6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium (PubChem CID 159042161) has the molecular formula C11H11N2+ and a molecular weight of 171.22 g/mol. Its IUPAC name is 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium.
| Compound Name | 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium |
|---|---|
| PubChem CID | 159042161 |
| Molecular Formula | C11H11N2+ |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium |
| SMILES | C=[n+]1cnccc1=C1C=CC=CC1 |
| InChI | InChI=1S/C11H11N2/c1-13-9-12-8-7-11(13)10-5-3-2-4-6-10/h2-5,7-9H,1,6H2/q+1 |
| InChIKey | YWGPWCYEFYFOQP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 18.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|