About 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium
6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium (PubChem CID 159042161) has the molecular formula C11H11N2+
and a molecular weight of 171.22 g/mol. Its IUPAC name is 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium.
Molecular Properties
| Compound Name | 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium |
| PubChem CID | 159042161 |
| Molecular Formula | C11H11N2+ |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium |
| SMILES | C=[n+]1cnccc1=C1C=CC=CC1 |
| InChI | InChI=1S/C11H11N2/c1-13-9-12-8-7-11(13)10-5-3-2-4-6-10/h2-5,7-9H,1,6H2/q+1 |
| InChIKey | YWGPWCYEFYFOQP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 18.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium?
The IUPAC name of 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium (CID 159042161) is 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium.
What is the SMILES notation for 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium?
The canonical SMILES for 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium is C=[n+]1cnccc1=C1C=CC=CC1.
What is the InChIKey of 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium?
The InChIKey is YWGPWCYEFYFOQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N2/c1-13-9-12-8-7-11(13)10-5-3-2-4-6-10/h2-5,7-9H,1,6H2/q+1.
What are the key properties of 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium?
6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium has a molecular weight of 171.22 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexa-2,4-dien-1-ylidene-1-methylidenepyrimidin-1-ium is sourced from PubChem (CID 159042161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).