C10H12S2 — CID 10936596
2-cyclohexa-2,4-dien-1-ylidene-1,3-dithiane (PubChem CID 10936596) has the molecular formula C10H12S2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-ylidene-1,3-dithiane.
| Compound Name | 2-cyclohexa-2,4-dien-1-ylidene-1,3-dithiane |
|---|---|
| PubChem CID | 10936596 |
| Molecular Formula | C10H12S2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-ylidene-1,3-dithiane |
| SMILES | C1=CCC(=C2SCCCS2)C=C1 |
| InChI | InChI=1S/C10H12S2/c1-2-5-9(6-3-1)10-11-7-4-8-12-10/h1-3,5H,4,6-8H2 |
| InChIKey | BCNWVBGFXLMFNF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |