C30H28N+ — CID 159442321
8-tert-butyl-4-(4-cyclohexa-2,4-dien-1-ylidenecyclohexa-2,5-dien-1-ylidene)-3-methylidenebenzo[f]isoquinolin-3-ium (PubChem CID 159442321) has the molecular formula C30H28N+ and a molecular weight of 402.56 g/mol. Its IUPAC name is 8-tert-butyl-4-(4-cyclohexa-2,4-dien-1-ylidenecyclohexa-2,5-dien-1-ylidene)-3-methylidenebenzo[f]isoquinolin-3-ium.
| Compound Name | 8-tert-butyl-4-(4-cyclohexa-2,4-dien-1-ylidenecyclohexa-2,5-dien-1-ylidene)-3-methylidenebenzo[f]isoquinolin-3-ium |
|---|---|
| PubChem CID | 159442321 |
| Molecular Formula | C30H28N+ |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 8-tert-butyl-4-(4-cyclohexa-2,4-dien-1-ylidenecyclohexa-2,5-dien-1-ylidene)-3-methylidenebenzo[f]isoquinolin-3-ium |
| SMILES | C=[n+]1ccc2c(ccc3cc(C(C)(C)C)ccc32)c1=c1ccc(=C2C=CC=CC2)cc1 |
| InChI | InChI=1S/C30H28N/c1-30(2,3)25-15-17-26-24(20-25)14-16-28-27(26)18-19-31(4)29(28)23-12-10-22(11-13-23)21-8-6-5-7-9-21/h5-8,10-20H,4,9H2,1-3H3/q+1/b22-21-,29-23+ |
| InChIKey | KRICUYQBGMVRGQ-DHSNSKFWSA-N |
| XLogP | 6.17 |
| TPSA | 5.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|