C47H34N4 — CID 134591892
4-[6-[7,14-dimethyl-13-(6-methylcyclohexa-2,4-dien-1-yl)-6-phenylquinolino[4,3-j]phenanthridin-3-yl]-2-pyridinyl]benzonitrile (PubChem CID 134591892) has the molecular formula C47H34N4 and a molecular weight of 654.82 g/mol. Its IUPAC name is 4-[6-[7,14-dimethyl-13-(6-methylcyclohexa-2,4-dien-1-yl)-6-phenylquinolino[4,3-j]phenanthridin-3-yl]-2-pyridinyl]benzonitrile.
| Compound Name | 4-[6-[7,14-dimethyl-13-(6-methylcyclohexa-2,4-dien-1-yl)-6-phenylquinolino[4,3-j]phenanthridin-3-yl]-2-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 134591892 |
| Molecular Formula | C47H34N4 |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 4-[6-[7,14-dimethyl-13-(6-methylcyclohexa-2,4-dien-1-yl)-6-phenylquinolino[4,3-j]phenanthridin-3-yl]-2-pyridinyl]benzonitrile |
| SMILES | Cc1c2c(C3C=CC=CC3C)nc3ccccc3c2c(C)c2c(-c3ccccc3)nc3cc(-c4cccc(-c5ccc(C#N)cc5)n4)ccc3c12 |
| InChI | InChI=1S/C47H34N4/c1-28-12-7-8-15-35(28)47-45-30(3)43-37-25-24-34(39-19-11-18-38(49-39)32-22-20-31(27-48)21-23-32)26-41(37)51-46(33-13-5-4-6-14-33)44(43)29(2)42(45)36-16-9-10-17-40(36)50-47/h4-26,28,35H,1-3H3 |
| InChIKey | CDHHNRCVKQDUMP-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|