C8H9F3IN — CID 134592155
2-(iodomethyl)-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]prop-2-en-1-imine (PubChem CID 134592155) has the molecular formula C8H9F3IN and a molecular weight of 303.07 g/mol. Its IUPAC name is 2-(iodomethyl)-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]prop-2-en-1-imine.
| Compound Name | 2-(iodomethyl)-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 134592155 |
| Molecular Formula | C8H9F3IN |
| Molecular Weight | 303.07 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 2-(iodomethyl)-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]prop-2-en-1-imine |
| SMILES | C=C(/C=N/C(=C\C)C(F)(F)F)CI |
| InChI | InChI=1S/C8H9F3IN/c1-3-7(8(9,10)11)13-5-6(2)4-12/h3,5H,2,4H2,1H3/b7-3-,13-5+ |
| InChIKey | ZAVBHAWHQVBKFJ-MUJVHBIESA-N |
| XLogP | 3.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.07 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|