About 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine
2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine (PubChem CID 142067133) has the molecular formula C7H8F3N
and a molecular weight of 163.14 g/mol. Its IUPAC name is 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine.
Molecular Properties
| Compound Name | 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine |
| PubChem CID | 142067133 |
| Molecular Formula | C7H8F3N |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine |
| SMILES | C=C(C)/C=N/C(=C)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N/c1-5(2)4-11-6(3)7(8,9)10/h4H,1,3H2,2H3/b11-4+ |
| InChIKey | VAMGLOAETNUVNI-NYYWCZLTSA-N |
| XLogP | 2.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine?
The IUPAC name of 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine (CID 142067133) is 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine.
What is the SMILES notation for 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine?
The canonical SMILES for 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine is C=C(C)/C=N/C(=C)C(F)(F)F.
What is the InChIKey of 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine?
The InChIKey is VAMGLOAETNUVNI-NYYWCZLTSA-N. The full InChI is InChI=1S/C7H8F3N/c1-5(2)4-11-6(3)7(8,9)10/h4H,1,3H2,2H3/b11-4+.
What are the key properties of 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine?
2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine has a molecular weight of 163.14 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)prop-2-en-1-imine is sourced from PubChem (CID 142067133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).