C23H26F3N3OS — CID 134592212
(1R,9R,13R)-1-amino-10-(cyclopropylmethyl)-13-[[3-(trifluoromethyl)phenyl]sulfanylamino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 134592212) has the molecular formula C23H26F3N3OS and a molecular weight of 449.54 g/mol. Its IUPAC name is (1R,9R,13R)-1-amino-10-(cyclopropylmethyl)-13-[[3-(trifluoromethyl)phenyl]sulfanylamino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9R,13R)-1-amino-10-(cyclopropylmethyl)-13-[[3-(trifluoromethyl)phenyl]sulfanylamino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 134592212 |
| Molecular Formula | C23H26F3N3OS |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | (1R,9R,13R)-1-amino-10-(cyclopropylmethyl)-13-[[3-(trifluoromethyl)phenyl]sulfanylamino]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | N[C@]12CCN(CC3CC3)[C@H](Cc3ccc(O)cc31)[C@H]2NSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H26F3N3OS/c24-23(25,26)16-2-1-3-18(11-16)31-28-21-20-10-15-6-7-17(30)12-19(15)22(21,27)8-9-29(20)13-14-4-5-14/h1-3,6-7,11-12,14,20-21,28,30H,4-5,8-10,13,27H2/t20-,21-,22-/m1/s1 |
| InChIKey | ORGBGSSOPQFPIQ-YPAWHYETSA-N |
| XLogP | 4.27 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|