C13H21NO5 — CID 134594169
(2S,4S)-4-(1-methoxyethenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 134594169) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is (2S,4S)-4-(1-methoxyethenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-(1-methoxyethenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 134594169 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (2S,4S)-4-(1-methoxyethenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | C=C(OC)[C@H]1C[C@@H](C(=O)O)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H21NO5/c1-8(18-5)9-6-10(11(15)16)14(7-9)12(17)19-13(2,3)4/h9-10H,1,6-7H2,2-5H3,(H,15,16)/t9-,10-/m0/s1 |
| InChIKey | DYHGUYLNEPXYJJ-UWVGGRQHSA-N |
| XLogP | 1.86 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|