C52H35F2N2OP — CID 134595923
3-(3-diphenylphosphorylphenyl)-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine (PubChem CID 134595923) has the molecular formula C52H35F2N2OP and a molecular weight of 772.84 g/mol. Its IUPAC name is 3-(3-diphenylphosphorylphenyl)-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine.
| Compound Name | 3-(3-diphenylphosphorylphenyl)-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine |
|---|---|
| PubChem CID | 134595923 |
| Molecular Formula | C52H35F2N2OP |
| Molecular Weight | 772.84 g/mol |
| Exact Mass | 772.25 |
| IUPAC Name | 3-(3-diphenylphosphorylphenyl)-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine |
| SMILES | Cc1c2c(-c3ccc(F)cc3)nc3cc(-c4cccc(P(=O)(c5ccccc5)c5ccccc5)c4)ccc3c2c(C)c2c(-c3ccc(F)cc3)nc3ccccc3c12 |
| InChI | InChI=1S/C52H35F2N2OP/c1-32-47-43-18-9-10-19-45(43)55-51(34-20-25-38(53)26-21-34)49(47)33(2)48-44-29-24-37(31-46(44)56-52(50(32)48)35-22-27-39(54)28-23-35)36-12-11-17-42(30-36)58(57,40-13-5-3-6-14-40)41-15-7-4-8-16-41/h3-31H,1-2H3 |
| InChIKey | URINBCOCKGEUNG-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.84 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|