C40H25N2OPS2 — CID 134596143
2-[7-[phenyl-(7-pyridin-2-yldibenzothiophen-3-yl)phosphoryl]dibenzothiophen-3-yl]pyridine (PubChem CID 134596143) has the molecular formula C40H25N2OPS2 and a molecular weight of 644.76 g/mol. Its IUPAC name is 2-[7-[phenyl-(7-pyridin-2-yldibenzothiophen-3-yl)phosphoryl]dibenzothiophen-3-yl]pyridine.
| Compound Name | 2-[7-[phenyl-(7-pyridin-2-yldibenzothiophen-3-yl)phosphoryl]dibenzothiophen-3-yl]pyridine |
|---|---|
| PubChem CID | 134596143 |
| Molecular Formula | C40H25N2OPS2 |
| Molecular Weight | 644.76 g/mol |
| Exact Mass | 644.11 |
| IUPAC Name | 2-[7-[phenyl-(7-pyridin-2-yldibenzothiophen-3-yl)phosphoryl]dibenzothiophen-3-yl]pyridine |
| SMILES | O=P(c1ccccc1)(c1ccc2c(c1)sc1cc(-c3ccccn3)ccc12)c1ccc2c(c1)sc1cc(-c3ccccn3)ccc12 |
| InChI | InChI=1S/C40H25N2OPS2/c43-44(28-8-2-1-3-9-28,29-14-18-33-31-16-12-26(35-10-4-6-20-41-35)22-37(31)45-39(33)24-29)30-15-19-34-32-17-13-27(36-11-5-7-21-42-36)23-38(32)46-40(34)25-30/h1-25H |
| InChIKey | NBEGFFKLQCLQDL-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.76 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|