C33H21N3S — CID 164817004
2-(5-dibenzothiophen-3-yl-2-pyridinyl)-4-phenyl-6-pyridin-2-ylpyridine (PubChem CID 164817004) has the molecular formula C33H21N3S and a molecular weight of 491.62 g/mol. Its IUPAC name is 2-(5-dibenzothiophen-3-yl-2-pyridinyl)-4-phenyl-6-pyridin-2-ylpyridine.
| Compound Name | 2-(5-dibenzothiophen-3-yl-2-pyridinyl)-4-phenyl-6-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 164817004 |
| Molecular Formula | C33H21N3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 2-(5-dibenzothiophen-3-yl-2-pyridinyl)-4-phenyl-6-pyridin-2-ylpyridine |
| SMILES | c1ccc(-c2cc(-c3ccccn3)nc(-c3ccc(-c4ccc5c(c4)sc4ccccc45)cn3)c2)cc1 |
| InChI | InChI=1S/C33H21N3S/c1-2-8-22(9-3-1)25-18-30(28-11-6-7-17-34-28)36-31(19-25)29-16-14-24(21-35-29)23-13-15-27-26-10-4-5-12-32(26)37-33(27)20-23/h1-21H |
| InChIKey | XTRNFLCDPZKMQS-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |