C49H31N5S — CID 153316115
2-[4-dibenzothiophen-3-yl-6-(4,6-diphenylpyrimidin-2-yl)-2-pyridinyl]-4,6-diphenylpyrimidine (PubChem CID 153316115) has the molecular formula C49H31N5S and a molecular weight of 721.89 g/mol. Its IUPAC name is 2-[4-dibenzothiophen-3-yl-6-(4,6-diphenylpyrimidin-2-yl)-2-pyridinyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[4-dibenzothiophen-3-yl-6-(4,6-diphenylpyrimidin-2-yl)-2-pyridinyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 153316115 |
| Molecular Formula | C49H31N5S |
| Molecular Weight | 721.89 g/mol |
| Exact Mass | 721.23 |
| IUPAC Name | 2-[4-dibenzothiophen-3-yl-6-(4,6-diphenylpyrimidin-2-yl)-2-pyridinyl]-4,6-diphenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cc(-c4ccc5c(c4)sc4ccccc45)cc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)n3)n2)cc1 |
| InChI | InChI=1S/C49H31N5S/c1-5-15-32(16-6-1)40-30-41(33-17-7-2-8-18-33)52-48(51-40)44-27-37(36-25-26-39-38-23-13-14-24-46(38)55-47(39)29-36)28-45(50-44)49-53-42(34-19-9-3-10-20-34)31-43(54-49)35-21-11-4-12-22-35/h1-31H |
| InChIKey | PZWJSBMVDYVQQL-UHFFFAOYSA-N |
| XLogP | 12.70 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.89 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |