C5H7FO4 — CID 134599825
methyl 4-fluoro-1,3-dioxolane-4-carboxylate (PubChem CID 134599825) has the molecular formula C5H7FO4 and a molecular weight of 150.10 g/mol. Its IUPAC name is methyl 4-fluoro-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl 4-fluoro-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 134599825 |
| Molecular Formula | C5H7FO4 |
| Molecular Weight | 150.10 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | methyl 4-fluoro-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)C1(F)COCO1 |
| InChI | InChI=1S/C5H7FO4/c1-8-4(7)5(6)2-9-3-10-5/h2-3H2,1H3 |
| InChIKey | RMVKWNFFIDEWAX-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.10 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |