C12H12ClFN2O — CID 134600413
3-chloro-1-[3-(3-fluorophenyl)-3,4-dihydropyrazol-2-yl]propan-1-one (PubChem CID 134600413) has the molecular formula C12H12ClFN2O and a molecular weight of 254.69 g/mol. Its IUPAC name is 3-chloro-1-[3-(3-fluorophenyl)-3,4-dihydropyrazol-2-yl]propan-1-one.
| Compound Name | 3-chloro-1-[3-(3-fluorophenyl)-3,4-dihydropyrazol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 134600413 |
| Molecular Formula | C12H12ClFN2O |
| Molecular Weight | 254.69 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-chloro-1-[3-(3-fluorophenyl)-3,4-dihydropyrazol-2-yl]propan-1-one |
| SMILES | O=C(CCCl)N1N=CCC1c1cccc(F)c1 |
| InChI | InChI=1S/C12H12ClFN2O/c13-6-4-12(17)16-11(5-7-15-16)9-2-1-3-10(14)8-9/h1-3,7-8,11H,4-6H2 |
| InChIKey | VBPBTYVKHJEHFV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.69 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|