C16H11ClF3N3O3S2 — CID 134602299
4-[(R)-amino-(2,6-difluorophenyl)methoxy]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 134602299) has the molecular formula C16H11ClF3N3O3S2 and a molecular weight of 449.86 g/mol. Its IUPAC name is 4-[(R)-amino-(2,6-difluorophenyl)methoxy]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[(R)-amino-(2,6-difluorophenyl)methoxy]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134602299 |
| Molecular Formula | C16H11ClF3N3O3S2 |
| Molecular Weight | 449.86 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | 4-[(R)-amino-(2,6-difluorophenyl)methoxy]-5-chloro-2-fluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | N[C@H](Oc1cc(F)c(S(=O)(=O)Nc2nccs2)cc1Cl)c1c(F)cccc1F |
| InChI | InChI=1S/C16H11ClF3N3O3S2/c17-8-6-13(28(24,25)23-16-22-4-5-27-16)11(20)7-12(8)26-15(21)14-9(18)2-1-3-10(14)19/h1-7,15H,21H2,(H,22,23)/t15-/m1/s1 |
| InChIKey | MWIJEMPXGZACNT-OAHLLOKOSA-N |
| XLogP | 4.05 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|