C26H33N3O7 — CID 134603813
(2S,5R)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(phenylmethoxyamino)piperidine-2-carboxylic acid (PubChem CID 134603813) has the molecular formula C26H33N3O7 and a molecular weight of 499.56 g/mol. Its IUPAC name is (2S,5R)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(phenylmethoxyamino)piperidine-2-carboxylic acid.
| Compound Name | (2S,5R)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(phenylmethoxyamino)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 134603813 |
| Molecular Formula | C26H33N3O7 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | (2S,5R)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(phenylmethoxyamino)piperidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](NOCc2ccccc2)CC[C@]1(C(=O)O)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C26H33N3O7/c1-25(2,3)36-24(34)28-15-18(27-35-16-17-9-5-4-6-10-17)13-14-26(28,23(32)33)29-21(30)19-11-7-8-12-20(19)22(29)31/h4-10,18-20,27H,11-16H2,1-3H3,(H,32,33)/t18-,19?,20?,26-/m1/s1 |
| InChIKey | YYFDYAWEXPIFRI-GWWOZFTFSA-N |
| XLogP | 2.84 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|