C19H25F3N2O4 — CID 76534508
tert-butyl 5-(phenylmethoxyamino)-1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate (PubChem CID 76534508) has the molecular formula C19H25F3N2O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is tert-butyl 5-(phenylmethoxyamino)-1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate.
| Compound Name | tert-butyl 5-(phenylmethoxyamino)-1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 76534508 |
| Molecular Formula | C19H25F3N2O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | tert-butyl 5-(phenylmethoxyamino)-1-(2,2,2-trifluoroacetyl)piperidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCC(NOCc2ccccc2)CN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C19H25F3N2O4/c1-18(2,3)28-16(25)15-10-9-14(11-24(15)17(26)19(20,21)22)23-27-12-13-7-5-4-6-8-13/h4-8,14-15,23H,9-12H2,1-3H3 |
| InChIKey | YSAXNPUTRAKHKF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|