C26H44N4O7Si — CID 131733976
2-trimethylsilylethyl (2S,5R)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxycarbamoyl]-5-(phenylmethoxyamino)piperidine-1-carboxylate (PubChem CID 131733976) has the molecular formula C26H44N4O7Si and a molecular weight of 552.75 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2S,5R)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxycarbamoyl]-5-(phenylmethoxyamino)piperidine-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl (2S,5R)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxycarbamoyl]-5-(phenylmethoxyamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 131733976 |
| Molecular Formula | C26H44N4O7Si |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 2-trimethylsilylethyl (2S,5R)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxycarbamoyl]-5-(phenylmethoxyamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCCONC(=O)[C@@H]1CC[C@@H](NOCc2ccccc2)CN1C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C26H44N4O7Si/c1-26(2,3)37-24(32)27-14-15-35-29-23(31)22-13-12-21(28-36-19-20-10-8-7-9-11-20)18-30(22)25(33)34-16-17-38(4,5)6/h7-11,21-22,28H,12-19H2,1-6H3,(H,27,32)(H,29,31)/t21-,22+/m1/s1 |
| InChIKey | RURWSSWAVQXQHB-YADHBBJMSA-N |
| XLogP | 3.59 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|