C21H34N4O5 — CID 118084529
tert-butyl N-[2-[[(2S,5R)-1-methyl-5-(phenylmethoxyamino)piperidine-2-carbonyl]amino]oxyethyl]carbamate (PubChem CID 118084529) has the molecular formula C21H34N4O5 and a molecular weight of 422.53 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2S,5R)-1-methyl-5-(phenylmethoxyamino)piperidine-2-carbonyl]amino]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2S,5R)-1-methyl-5-(phenylmethoxyamino)piperidine-2-carbonyl]amino]oxyethyl]carbamate |
|---|---|
| PubChem CID | 118084529 |
| Molecular Formula | C21H34N4O5 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | tert-butyl N-[2-[[(2S,5R)-1-methyl-5-(phenylmethoxyamino)piperidine-2-carbonyl]amino]oxyethyl]carbamate |
| SMILES | CN1C[C@H](NOCc2ccccc2)CC[C@H]1C(=O)NOCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34N4O5/c1-21(2,3)30-20(27)22-12-13-28-24-19(26)18-11-10-17(14-25(18)4)23-29-15-16-8-6-5-7-9-16/h5-9,17-18,23H,10-15H2,1-4H3,(H,22,27)(H,24,26)/t17-,18+/m1/s1 |
| InChIKey | UVNBLUIYVOWLAZ-MSOLQXFVSA-N |
| XLogP | 1.74 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|