C25H32N2O6 — CID 122436930
(2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-[(2-phenylmethoxyphenyl)methoxyamino]piperidine-2-carboxylic acid (PubChem CID 122436930) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is (2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-[(2-phenylmethoxyphenyl)methoxyamino]piperidine-2-carboxylic acid.
| Compound Name | (2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-[(2-phenylmethoxyphenyl)methoxyamino]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122436930 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-[(2-phenylmethoxyphenyl)methoxyamino]piperidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](NOCc2ccccc2OCc2ccccc2)CC[C@H]1C(=O)O |
| InChI | InChI=1S/C25H32N2O6/c1-25(2,3)33-24(30)27-15-20(13-14-21(27)23(28)29)26-32-17-19-11-7-8-12-22(19)31-16-18-9-5-4-6-10-18/h4-12,20-21,26H,13-17H2,1-3H3,(H,28,29)/t20-,21+/m1/s1 |
| InChIKey | YLPOJJHBVMFQRT-RTWAWAEBSA-N |
| XLogP | 4.14 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|