C21H13ClF3N5O3 — CID 134609752
methyl 6-chloro-4-[[1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]pyridine-2-carboxylate (PubChem CID 134609752) has the molecular formula C21H13ClF3N5O3 and a molecular weight of 475.81 g/mol. Its IUPAC name is methyl 6-chloro-4-[[1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]pyridine-2-carboxylate.
| Compound Name | methyl 6-chloro-4-[[1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134609752 |
| Molecular Formula | C21H13ClF3N5O3 |
| Molecular Weight | 475.81 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | methyl 6-chloro-4-[[1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2cnn(-c3cncc4ccccc34)c2C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C21H13ClF3N5O3/c1-33-20(32)15-6-12(7-17(22)29-15)28-19(31)14-9-27-30(18(14)21(23,24)25)16-10-26-8-11-4-2-3-5-13(11)16/h2-10H,1H3,(H,28,29,31) |
| InChIKey | JHEARKKJFUGUHM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.81 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|