C28H37N7O3S — CID 134612127
5-(1,3-benzothiazol-2-yl)-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-propan-2-ylcyclopentyl]amino]-2-(4-pyrimidin-5-ylpiperidin-1-yl)-1,3-diazinan-4-one (PubChem CID 134612127) has the molecular formula C28H37N7O3S and a molecular weight of 551.72 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-propan-2-ylcyclopentyl]amino]-2-(4-pyrimidin-5-ylpiperidin-1-yl)-1,3-diazinan-4-one.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-propan-2-ylcyclopentyl]amino]-2-(4-pyrimidin-5-ylpiperidin-1-yl)-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 134612127 |
| Molecular Formula | C28H37N7O3S |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-propan-2-ylcyclopentyl]amino]-2-(4-pyrimidin-5-ylpiperidin-1-yl)-1,3-diazinan-4-one |
| SMILES | CC(C)[C@H]1C[C@@H](NC2NC(N3CCC(c4cncnc4)CC3)NC(=O)C2c2nc3ccccc3s2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H37N7O3S/c1-15(2)18-11-20(24(37)23(18)36)31-25-22(27-32-19-5-3-4-6-21(19)39-27)26(38)34-28(33-25)35-9-7-16(8-10-35)17-12-29-14-30-13-17/h3-6,12-16,18,20,22-25,28,31,33,36-37H,7-11H2,1-2H3,(H,34,38)/t18-,20-,22?,23-,24+,25?,28?/m1/s1 |
| InChIKey | JTVZZCHCJQDKJL-LLDWUZIMSA-N |
| XLogP | 1.73 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |