C26H33N7O4S — CID 134612026
5-(1,3-benzothiazol-2-yl)-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-2-(4-pyrazin-2-ylpiperidin-1-yl)-1,3-diazinan-4-one (PubChem CID 134612026) has the molecular formula C26H33N7O4S and a molecular weight of 539.66 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-2-(4-pyrazin-2-ylpiperidin-1-yl)-1,3-diazinan-4-one.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-2-(4-pyrazin-2-ylpiperidin-1-yl)-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 134612026 |
| Molecular Formula | C26H33N7O4S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-2-(4-pyrazin-2-ylpiperidin-1-yl)-1,3-diazinan-4-one |
| SMILES | O=C1NC(N2CCC(c3cnccn3)CC2)NC(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)C1c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H33N7O4S/c34-13-15-11-17(22(36)21(15)35)29-23-20(25-30-16-3-1-2-4-19(16)38-25)24(37)32-26(31-23)33-9-5-14(6-10-33)18-12-27-7-8-28-18/h1-4,7-8,12,14-15,17,20-23,26,29,31,34-36H,5-6,9-11,13H2,(H,32,37)/t15-,17-,20?,21-,22+,23?,26?/m1/s1 |
| InChIKey | CIKHNDZSSMLZMZ-KVZSTNGOSA-N |
| XLogP | 0.07 |
| TPSA | 155.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |