C23H23N5O4S — CID 123539977
2-anilino-3-(1,3-benzothiazol-2-yl)-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]pyrimidin-4-one (PubChem CID 123539977) has the molecular formula C23H23N5O4S and a molecular weight of 465.54 g/mol. Its IUPAC name is 2-anilino-3-(1,3-benzothiazol-2-yl)-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]pyrimidin-4-one.
| Compound Name | 2-anilino-3-(1,3-benzothiazol-2-yl)-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]pyrimidin-4-one |
|---|---|
| PubChem CID | 123539977 |
| Molecular Formula | C23H23N5O4S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-anilino-3-(1,3-benzothiazol-2-yl)-6-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]pyrimidin-4-one |
| SMILES | O=c1cc(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)nc(Nc2ccccc2)n1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H23N5O4S/c29-12-13-10-16(21(32)20(13)31)25-18-11-19(30)28(22(27-18)24-14-6-2-1-3-7-14)23-26-15-8-4-5-9-17(15)33-23/h1-9,11,13,16,20-21,25,29,31-32H,10,12H2,(H,24,27)/t13-,16-,20-,21+/m1/s1 |
| InChIKey | QZYNOUQVNXMPPO-LOFXOBHGSA-N |
| XLogP | 2.10 |
| TPSA | 132.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |