C24H28N6O6S — CID 136984053
8-[5-(1,3-benzothiazol-2-yl)-4-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-6-oxo-1H-pyrimidin-2-yl]-3-oxa-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 136984053) has the molecular formula C24H28N6O6S and a molecular weight of 528.59 g/mol. Its IUPAC name is 8-[5-(1,3-benzothiazol-2-yl)-4-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-6-oxo-1H-pyrimidin-2-yl]-3-oxa-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-[5-(1,3-benzothiazol-2-yl)-4-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-6-oxo-1H-pyrimidin-2-yl]-3-oxa-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 136984053 |
| Molecular Formula | C24H28N6O6S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 8-[5-(1,3-benzothiazol-2-yl)-4-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-6-oxo-1H-pyrimidin-2-yl]-3-oxa-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1NC2(CCN(c3nc(N[C@@H]4C[C@H](CO)[C@@H](O)[C@H]4O)c(-c4nc5ccccc5s4)c(=O)[nH]3)CC2)CO1 |
| InChI | InChI=1S/C24H28N6O6S/c31-10-12-9-14(18(33)17(12)32)25-19-16(21-26-13-3-1-2-4-15(13)37-21)20(34)28-22(27-19)30-7-5-24(6-8-30)11-36-23(35)29-24/h1-4,12,14,17-18,31-33H,5-11H2,(H,29,35)(H2,25,27,28,34)/t12-,14-,17-,18+/m1/s1 |
| InChIKey | DNRSDCCFPUSXAE-FOZNTRSISA-N |
| XLogP | 0.64 |
| TPSA | 172.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |