C23H26FN5O5S — CID 136983809
4-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-morpholin-4-yl-1H-pyrimidin-6-one (PubChem CID 136983809) has the molecular formula C23H26FN5O5S and a molecular weight of 503.56 g/mol. Its IUPAC name is 4-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-morpholin-4-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-morpholin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136983809 |
| Molecular Formula | C23H26FN5O5S |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 4-[[(1R,2S,3R,4R)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]amino]-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-morpholin-4-yl-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(N2CCOCC2)nc(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)c1-c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C23H26FN5O5S/c24-14-3-1-12(2-4-14)16-11-35-22(26-16)17-20(25-15-9-13(10-30)18(31)19(15)32)27-23(28-21(17)33)29-5-7-34-8-6-29/h1-4,11,13,15,18-19,30-32H,5-10H2,(H2,25,27,28,33)/t13-,15-,18-,19+/m1/s1 |
| InChIKey | IUPSBXPZJLTHHL-LRHNDGHRSA-N |
| XLogP | 1.05 |
| TPSA | 143.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |